C26H20O3 — CID 174265222
2-benzofuran-1,3-dione;1,2,3,4-tetrahydrochrysene (PubChem CID 174265222) has the molecular formula C26H20O3 and a molecular weight of 380.44 g/mol. Its IUPAC name is 2-benzofuran-1,3-dione;1,2,3,4-tetrahydrochrysene.
| Compound Name | 2-benzofuran-1,3-dione;1,2,3,4-tetrahydrochrysene |
|---|---|
| PubChem CID | 174265222 |
| Molecular Formula | C26H20O3 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.14 |
| IUPAC Name | 2-benzofuran-1,3-dione;1,2,3,4-tetrahydrochrysene |
| SMILES | O=C1OC(=O)c2ccccc21.c1ccc2c(c1)ccc1c3c(ccc12)CCCC3 |
| InChI | InChI=1S/C18H16.C8H4O3/c1-3-7-15-13(5-1)9-11-18-16-8-4-2-6-14(16)10-12-17(15)18;9-7-5-3-1-2-4-6(5)8(10)11-7/h1,3,5,7,9-12H,2,4,6,8H2;1-4H |
| InChIKey | PMDNWTPDEGTZHH-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|