C27H20O3 — CID 174501562
2-benzofuran-1,3-dione;1-methylidene-3,4-dihydro-2H-chrysene (PubChem CID 174501562) has the molecular formula C27H20O3 and a molecular weight of 392.45 g/mol. Its IUPAC name is 2-benzofuran-1,3-dione;1-methylidene-3,4-dihydro-2H-chrysene.
| Compound Name | 2-benzofuran-1,3-dione;1-methylidene-3,4-dihydro-2H-chrysene |
|---|---|
| PubChem CID | 174501562 |
| Molecular Formula | C27H20O3 |
| Molecular Weight | 392.45 g/mol |
| Exact Mass | 392.14 |
| IUPAC Name | 2-benzofuran-1,3-dione;1-methylidene-3,4-dihydro-2H-chrysene |
| SMILES | C=C1CCCc2c1ccc1c2ccc2ccccc21.O=C1OC(=O)c2ccccc21 |
| InChI | InChI=1S/C19H16.C8H4O3/c1-13-5-4-8-17-15(13)11-12-18-16-7-3-2-6-14(16)9-10-19(17)18;9-7-5-3-1-2-4-6(5)8(10)11-7/h2-3,6-7,9-12H,1,4-5,8H2;1-4H |
| InChIKey | BXWVBBGGRGWXPI-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.45 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|