C26H16O3 — CID 174655978
5-(5,6-dihydrochrysen-1-yl)-2-benzofuran-1,3-dione (PubChem CID 174655978) has the molecular formula C26H16O3 and a molecular weight of 376.41 g/mol. Its IUPAC name is 5-(5,6-dihydrochrysen-1-yl)-2-benzofuran-1,3-dione.
| Compound Name | 5-(5,6-dihydrochrysen-1-yl)-2-benzofuran-1,3-dione |
|---|---|
| PubChem CID | 174655978 |
| Molecular Formula | C26H16O3 |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.11 |
| IUPAC Name | 5-(5,6-dihydrochrysen-1-yl)-2-benzofuran-1,3-dione |
| SMILES | O=C1OC(=O)c2cc(-c3cccc4c5c(ccc34)-c3ccccc3CC5)ccc21 |
| InChI | InChI=1S/C26H16O3/c27-25-23-11-9-16(14-24(23)26(28)29-25)18-6-3-7-19-21(18)13-12-20-17-5-2-1-4-15(17)8-10-22(19)20/h1-7,9,11-14H,8,10H2 |
| InChIKey | ISZBWNJYOVKIBX-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|