C34H18O6 — CID 102372125
5-[4-[4-[4-(1,3-dioxo-2-benzofuran-5-yl)phenyl]phenyl]phenyl]-2-benzofuran-1,3-dione (PubChem CID 102372125) has the molecular formula C34H18O6 and a molecular weight of 522.51 g/mol. Its IUPAC name is 5-[4-[4-[4-(1,3-dioxo-2-benzofuran-5-yl)phenyl]phenyl]phenyl]-2-benzofuran-1,3-dione.
| Compound Name | 5-[4-[4-[4-(1,3-dioxo-2-benzofuran-5-yl)phenyl]phenyl]phenyl]-2-benzofuran-1,3-dione |
|---|---|
| PubChem CID | 102372125 |
| Molecular Formula | C34H18O6 |
| Molecular Weight | 522.51 g/mol |
| Exact Mass | 522.11 |
| IUPAC Name | 5-[4-[4-[4-(1,3-dioxo-2-benzofuran-5-yl)phenyl]phenyl]phenyl]-2-benzofuran-1,3-dione |
| SMILES | O=C1OC(=O)c2cc(-c3ccc(-c4ccc(-c5ccc(-c6ccc7c(c6)C(=O)OC7=O)cc5)cc4)cc3)ccc21 |
| InChI | InChI=1S/C34H18O6/c35-31-27-15-13-25(17-29(27)33(37)39-31)23-9-5-21(6-10-23)19-1-2-20(4-3-19)22-7-11-24(12-8-22)26-14-16-28-30(18-26)34(38)40-32(28)36/h1-18H |
| InChIKey | QWAKIWAZDCSTSD-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.51 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|