C16H6F2O6 — CID 159746884
5-fluoro-2-benzofuran-1,3-dione (PubChem CID 159746884) has the molecular formula C16H6F2O6 and a molecular weight of 332.21 g/mol. Its IUPAC name is 5-fluoro-2-benzofuran-1,3-dione.
| Compound Name | 5-fluoro-2-benzofuran-1,3-dione |
|---|---|
| PubChem CID | 159746884 |
| Molecular Formula | C16H6F2O6 |
| Molecular Weight | 332.21 g/mol |
| Exact Mass | 332.01 |
| IUPAC Name | 5-fluoro-2-benzofuran-1,3-dione |
| SMILES | O=C1OC(=O)c2cc(F)ccc21.O=C1OC(=O)c2cc(F)ccc21 |
| InChI | InChI=1S/2C8H3FO3/c2*9-4-1-2-5-6(3-4)8(11)12-7(5)10/h2*1-3H |
| InChIKey | NDDMUWCRRYMWPO-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.21 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|