C18H6O8 — CID 118399224
5-[2-(1,3-dioxo-2-benzofuran-5-yl)-2-oxoacetyl]-2-benzofuran-1,3-dione (PubChem CID 118399224) has the molecular formula C18H6O8 and a molecular weight of 350.24 g/mol. Its IUPAC name is 5-[2-(1,3-dioxo-2-benzofuran-5-yl)-2-oxoacetyl]-2-benzofuran-1,3-dione.
| Compound Name | 5-[2-(1,3-dioxo-2-benzofuran-5-yl)-2-oxoacetyl]-2-benzofuran-1,3-dione |
|---|---|
| PubChem CID | 118399224 |
| Molecular Formula | C18H6O8 |
| Molecular Weight | 350.24 g/mol |
| Exact Mass | 350.01 |
| IUPAC Name | 5-[2-(1,3-dioxo-2-benzofuran-5-yl)-2-oxoacetyl]-2-benzofuran-1,3-dione |
| SMILES | O=C(C(=O)c1ccc2c(c1)C(=O)OC2=O)c1ccc2c(c1)C(=O)OC2=O |
| InChI | InChI=1S/C18H6O8/c19-13(7-1-3-9-11(5-7)17(23)25-15(9)21)14(20)8-2-4-10-12(6-8)18(24)26-16(10)22/h1-6H |
| InChIKey | QLXWZTGEWCADGB-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 120.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.24 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|