C14H10FNO2 — CID 174849792
benzene;5-fluoroisoindole-1,3-dione (PubChem CID 174849792) has the molecular formula C14H10FNO2 and a molecular weight of 243.24 g/mol. Its IUPAC name is benzene;5-fluoroisoindole-1,3-dione.
| Compound Name | benzene;5-fluoroisoindole-1,3-dione |
|---|---|
| PubChem CID | 174849792 |
| Molecular Formula | C14H10FNO2 |
| Molecular Weight | 243.24 g/mol |
| Exact Mass | 243.07 |
| IUPAC Name | benzene;5-fluoroisoindole-1,3-dione |
| SMILES | O=C1NC(=O)c2cc(F)ccc21.c1ccccc1 |
| InChI | InChI=1S/C8H4FNO2.C6H6/c9-4-1-2-5-6(3-4)8(12)10-7(5)11;1-2-4-6-5-3-1/h1-3H,(H,10,11,12);1-6H |
| InChIKey | JKBSXRLOAMAVFX-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.24 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|