C8H5LiNO2+ — CID 18764300
lithium isoindole-1,3-dione (PubChem CID 18764300) has the molecular formula C8H5LiNO2+ and a molecular weight of 154.07 g/mol. Its IUPAC name is lithium isoindole-1,3-dione.
| Compound Name | lithium isoindole-1,3-dione |
|---|---|
| PubChem CID | 18764300 |
| Molecular Formula | C8H5LiNO2+ |
| Molecular Weight | 154.07 g/mol |
| Exact Mass | 154.05 |
| IUPAC Name | lithium isoindole-1,3-dione |
| SMILES | O=C1NC(=O)c2ccccc21.[Li+] |
| InChI | InChI=1S/C8H5NO2.Li/c10-7-5-3-1-2-4-6(5)8(11)9-7;/h1-4H,(H,9,10,11);/q;+1 |
| InChIKey | VXNVNGCOOZWFJK-UHFFFAOYSA-N |
| XLogP | -2.43 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.07 |
| LogP ≤ 5 | -2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|