About isoindole-1,3-dione;phosphane
isoindole-1,3-dione;phosphane (PubChem CID 89428738) has the molecular formula C8H8NO2P
and a molecular weight of 181.13 g/mol. Its IUPAC name is isoindole-1,3-dione;phosphane.
Molecular Properties
| Compound Name | isoindole-1,3-dione;phosphane |
| PubChem CID | 89428738 |
| Molecular Formula | C8H8NO2P |
| Molecular Weight | 181.13 g/mol |
| Exact Mass | 181.03 |
| IUPAC Name | isoindole-1,3-dione;phosphane |
| SMILES | O=C1NC(=O)c2ccccc21.P |
| InChI | InChI=1S/C8H5NO2.H3P/c10-7-5-3-1-2-4-6(5)8(11)9-7;/h1-4H,(H,9,10,11);1H3 |
| InChIKey | KCZRWWPPRBRLLM-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.13 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze isoindole-1,3-dione;phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of isoindole-1,3-dione;phosphane?
The IUPAC name of isoindole-1,3-dione;phosphane (CID 89428738) is isoindole-1,3-dione;phosphane.
What is the SMILES notation for isoindole-1,3-dione;phosphane?
The canonical SMILES for isoindole-1,3-dione;phosphane is O=C1NC(=O)c2ccccc21.P.
What is the InChIKey of isoindole-1,3-dione;phosphane?
The InChIKey is KCZRWWPPRBRLLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5NO2.H3P/c10-7-5-3-1-2-4-6(5)8(11)9-7;/h1-4H,(H,9,10,11);1H3.
What are the key properties of isoindole-1,3-dione;phosphane?
isoindole-1,3-dione;phosphane has a molecular weight of 181.13 g/mol, XLogP of 0.63, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for isoindole-1,3-dione;phosphane is sourced from PubChem (CID 89428738), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).