C26H23NO5 — CID 157178846
isoindole-1,3-dione;phenol (PubChem CID 157178846) has the molecular formula C26H23NO5 and a molecular weight of 429.47 g/mol. Its IUPAC name is isoindole-1,3-dione;phenol.
| Compound Name | isoindole-1,3-dione;phenol |
|---|---|
| PubChem CID | 157178846 |
| Molecular Formula | C26H23NO5 |
| Molecular Weight | 429.47 g/mol |
| Exact Mass | 429.16 |
| IUPAC Name | isoindole-1,3-dione;phenol |
| SMILES | O=C1NC(=O)c2ccccc21.Oc1ccccc1.Oc1ccccc1.Oc1ccccc1 |
| InChI | InChI=1S/C8H5NO2.3C6H6O/c10-7-5-3-1-2-4-6(5)8(11)9-7;3*7-6-4-2-1-3-5-6/h1-4H,(H,9,10,11);3*1-5,7H |
| InChIKey | AOILTOGQAUQZQN-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.47 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|