C22H15NO3 — CID 69299833
phenol;5-(2-phenylethynyl)isoindole-1,3-dione (PubChem CID 69299833) has the molecular formula C22H15NO3 and a molecular weight of 341.37 g/mol. Its IUPAC name is phenol;5-(2-phenylethynyl)isoindole-1,3-dione.
| Compound Name | phenol;5-(2-phenylethynyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 69299833 |
| Molecular Formula | C22H15NO3 |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.11 |
| IUPAC Name | phenol;5-(2-phenylethynyl)isoindole-1,3-dione |
| SMILES | O=C1NC(=O)c2cc(C#Cc3ccccc3)ccc21.Oc1ccccc1 |
| InChI | InChI=1S/C16H9NO2.C6H6O/c18-15-13-9-8-12(10-14(13)16(19)17-15)7-6-11-4-2-1-3-5-11;7-6-4-2-1-3-5-6/h1-5,8-10H,(H,17,18,19);1-5,7H |
| InChIKey | VGUNYBQIBBJHBW-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|