About phenol;5-(2-phenylethynyl)isoindole-1,3-dione
phenol;5-(2-phenylethynyl)isoindole-1,3-dione (PubChem CID 69299833) has the molecular formula C22H15NO3
and a molecular weight of 341.37 g/mol. Its IUPAC name is phenol;5-(2-phenylethynyl)isoindole-1,3-dione.
Molecular Properties
| Compound Name | phenol;5-(2-phenylethynyl)isoindole-1,3-dione |
| PubChem CID | 69299833 |
| Molecular Formula | C22H15NO3 |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.11 |
| IUPAC Name | phenol;5-(2-phenylethynyl)isoindole-1,3-dione |
| SMILES | O=C1NC(=O)c2cc(C#Cc3ccccc3)ccc21.Oc1ccccc1 |
| InChI | InChI=1S/C16H9NO2.C6H6O/c18-15-13-9-8-12(10-14(13)16(19)17-15)7-6-11-4-2-1-3-5-11;7-6-4-2-1-3-5-6/h1-5,8-10H,(H,17,18,19);1-5,7H |
| InChIKey | VGUNYBQIBBJHBW-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze phenol;5-(2-phenylethynyl)isoindole-1,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenol;5-(2-phenylethynyl)isoindole-1,3-dione?
The IUPAC name of phenol;5-(2-phenylethynyl)isoindole-1,3-dione (CID 69299833) is phenol;5-(2-phenylethynyl)isoindole-1,3-dione.
What is the SMILES notation for phenol;5-(2-phenylethynyl)isoindole-1,3-dione?
The canonical SMILES for phenol;5-(2-phenylethynyl)isoindole-1,3-dione is O=C1NC(=O)c2cc(C#Cc3ccccc3)ccc21.Oc1ccccc1.
What is the InChIKey of phenol;5-(2-phenylethynyl)isoindole-1,3-dione?
The InChIKey is VGUNYBQIBBJHBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H9NO2.C6H6O/c18-15-13-9-8-12(10-14(13)16(19)17-15)7-6-11-4-2-1-3-5-11;7-6-4-2-1-3-5-6/h1-5,8-10H,(H,17,18,19);1-5,7H.
What are the key properties of phenol;5-(2-phenylethynyl)isoindole-1,3-dione?
phenol;5-(2-phenylethynyl)isoindole-1,3-dione has a molecular weight of 341.37 g/mol, XLogP of 3.36, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for phenol;5-(2-phenylethynyl)isoindole-1,3-dione is sourced from PubChem (CID 69299833), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).