C28H18N2O4 — CID 160590417
5-ethynyl-2-methylisoindole-1,3-dione;2-methyl-5-(2-phenylethynyl)isoindole-1,3-dione (PubChem CID 160590417) has the molecular formula C28H18N2O4 and a molecular weight of 446.46 g/mol. Its IUPAC name is 5-ethynyl-2-methylisoindole-1,3-dione;2-methyl-5-(2-phenylethynyl)isoindole-1,3-dione.
| Compound Name | 5-ethynyl-2-methylisoindole-1,3-dione;2-methyl-5-(2-phenylethynyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 160590417 |
| Molecular Formula | C28H18N2O4 |
| Molecular Weight | 446.46 g/mol |
| Exact Mass | 446.13 |
| IUPAC Name | 5-ethynyl-2-methylisoindole-1,3-dione;2-methyl-5-(2-phenylethynyl)isoindole-1,3-dione |
| SMILES | C#Cc1ccc2c(c1)C(=O)N(C)C2=O.CN1C(=O)c2ccc(C#Cc3ccccc3)cc2C1=O |
| InChI | InChI=1S/C17H11NO2.C11H7NO2/c1-18-16(19)14-10-9-13(11-15(14)17(18)20)8-7-12-5-3-2-4-6-12;1-3-7-4-5-8-9(6-7)11(14)12(2)10(8)13/h2-6,9-11H,1H3;1,4-6H,2H3 |
| InChIKey | RCXZYCYPGQYSON-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.46 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|