C46H25NO6 — CID 59572185
bis[3-(2-phenylethynyl)phenyl] 5-(5-ethynyl-1,3-dioxoisoindol-2-yl)benzene-1,3-dicarboxylate (PubChem CID 59572185) has the molecular formula C46H25NO6 and a molecular weight of 687.71 g/mol. Its IUPAC name is bis[3-(2-phenylethynyl)phenyl] 5-(5-ethynyl-1,3-dioxoisoindol-2-yl)benzene-1,3-dicarboxylate.
| Compound Name | bis[3-(2-phenylethynyl)phenyl] 5-(5-ethynyl-1,3-dioxoisoindol-2-yl)benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 59572185 |
| Molecular Formula | C46H25NO6 |
| Molecular Weight | 687.71 g/mol |
| Exact Mass | 687.17 |
| IUPAC Name | bis[3-(2-phenylethynyl)phenyl] 5-(5-ethynyl-1,3-dioxoisoindol-2-yl)benzene-1,3-dicarboxylate |
| SMILES | C#Cc1ccc2c(c1)C(=O)N(c1cc(C(=O)Oc3cccc(C#Cc4ccccc4)c3)cc(C(=O)Oc3cccc(C#Cc4ccccc4)c3)c1)C2=O |
| InChI | InChI=1S/C46H25NO6/c1-2-31-23-24-41-42(27-31)44(49)47(43(41)48)38-29-36(45(50)52-39-17-9-15-34(25-39)21-19-32-11-5-3-6-12-32)28-37(30-38)46(51)53-40-18-10-16-35(26-40)22-20-33-13-7-4-8-14-33/h1,3-18,23-30H |
| InChIKey | CSMYXQIPJPDVII-UHFFFAOYSA-N |
| XLogP | 7.71 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.71 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|