C35H18N4O5 — CID 59572124
1-[3,5-bis(5-ethynyl-1,3-dioxoisoindol-2-yl)phenyl]-3-(3-ethynylphenyl)urea (PubChem CID 59572124) has the molecular formula C35H18N4O5 and a molecular weight of 574.55 g/mol. Its IUPAC name is 1-[3,5-bis(5-ethynyl-1,3-dioxoisoindol-2-yl)phenyl]-3-(3-ethynylphenyl)urea.
| Compound Name | 1-[3,5-bis(5-ethynyl-1,3-dioxoisoindol-2-yl)phenyl]-3-(3-ethynylphenyl)urea |
|---|---|
| PubChem CID | 59572124 |
| Molecular Formula | C35H18N4O5 |
| Molecular Weight | 574.55 g/mol |
| Exact Mass | 574.13 |
| IUPAC Name | 1-[3,5-bis(5-ethynyl-1,3-dioxoisoindol-2-yl)phenyl]-3-(3-ethynylphenyl)urea |
| SMILES | C#Cc1cccc(NC(=O)Nc2cc(N3C(=O)c4ccc(C#C)cc4C3=O)cc(N3C(=O)c4ccc(C#C)cc4C3=O)c2)c1 |
| InChI | InChI=1S/C35H18N4O5/c1-4-20-8-7-9-23(14-20)36-35(44)37-24-17-25(38-31(40)27-12-10-21(5-2)15-29(27)33(38)42)19-26(18-24)39-32(41)28-13-11-22(6-3)16-30(28)34(39)43/h1-3,7-19H,(H2,36,37,44) |
| InChIKey | CSPLWEBVGJNUSA-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 115.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.55 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|