C15H11FN2O3S — CID 118560123
4-[(3-ethynylphenyl)carbamoylamino]benzenesulfonyl fluoride (PubChem CID 118560123) has the molecular formula C15H11FN2O3S and a molecular weight of 318.33 g/mol. Its IUPAC name is 4-[(3-ethynylphenyl)carbamoylamino]benzenesulfonyl fluoride.
| Compound Name | 4-[(3-ethynylphenyl)carbamoylamino]benzenesulfonyl fluoride |
|---|---|
| PubChem CID | 118560123 |
| Molecular Formula | C15H11FN2O3S |
| Molecular Weight | 318.33 g/mol |
| Exact Mass | 318.05 |
| IUPAC Name | 4-[(3-ethynylphenyl)carbamoylamino]benzenesulfonyl fluoride |
| SMILES | C#Cc1cccc(NC(=O)Nc2ccc(S(=O)(=O)F)cc2)c1 |
| InChI | InChI=1S/C15H11FN2O3S/c1-2-11-4-3-5-13(10-11)18-15(19)17-12-6-8-14(9-7-12)22(16,20)21/h1,3-10H,(H2,17,18,19) |
| InChIKey | OHAWXTIEMQUDAT-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.33 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|