C25H17LiN4O4 — CID 59499694
lithium 3,5-bis[(3-ethynylphenyl)carbamoylamino]benzoate (PubChem CID 59499694) has the molecular formula C25H17LiN4O4 and a molecular weight of 444.38 g/mol. Its IUPAC name is lithium 3,5-bis[(3-ethynylphenyl)carbamoylamino]benzoate.
| Compound Name | lithium 3,5-bis[(3-ethynylphenyl)carbamoylamino]benzoate |
|---|---|
| PubChem CID | 59499694 |
| Molecular Formula | C25H17LiN4O4 |
| Molecular Weight | 444.38 g/mol |
| Exact Mass | 444.14 |
| IUPAC Name | lithium 3,5-bis[(3-ethynylphenyl)carbamoylamino]benzoate |
| SMILES | C#Cc1cccc(NC(=O)Nc2cc(NC(=O)Nc3cccc(C#C)c3)cc(C(=O)[O-])c2)c1.[Li+] |
| InChI | InChI=1S/C25H18N4O4.Li/c1-3-16-7-5-9-19(11-16)26-24(32)28-21-13-18(23(30)31)14-22(15-21)29-25(33)27-20-10-6-8-17(4-2)12-20;/h1-2,5-15H,(H,30,31)(H2,26,28,32)(H2,27,29,33);/q;+1/p-1 |
| InChIKey | VPMSWRXIOHLEQV-UHFFFAOYSA-M |
| XLogP | 0.30 |
| TPSA | 122.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.38 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|