C33H22N4O3 — CID 59499518
1-N,3-N-bis(3-ethynylphenyl)-5-[(3-ethynylphenyl)carbamoylamino]benzene-1,3-dicarboxamide (PubChem CID 59499518) has the molecular formula C33H22N4O3 and a molecular weight of 522.56 g/mol. Its IUPAC name is 1-N,3-N-bis(3-ethynylphenyl)-5-[(3-ethynylphenyl)carbamoylamino]benzene-1,3-dicarboxamide.
| Compound Name | 1-N,3-N-bis(3-ethynylphenyl)-5-[(3-ethynylphenyl)carbamoylamino]benzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 59499518 |
| Molecular Formula | C33H22N4O3 |
| Molecular Weight | 522.56 g/mol |
| Exact Mass | 522.17 |
| IUPAC Name | 1-N,3-N-bis(3-ethynylphenyl)-5-[(3-ethynylphenyl)carbamoylamino]benzene-1,3-dicarboxamide |
| SMILES | C#Cc1cccc(NC(=O)Nc2cc(C(=O)Nc3cccc(C#C)c3)cc(C(=O)Nc3cccc(C#C)c3)c2)c1 |
| InChI | InChI=1S/C33H22N4O3/c1-4-22-10-7-13-27(16-22)34-31(38)25-19-26(32(39)35-28-14-8-11-23(5-2)17-28)21-30(20-25)37-33(40)36-29-15-9-12-24(6-3)18-29/h1-3,7-21H,(H,34,38)(H,35,39)(H2,36,37,40) |
| InChIKey | YWGYHCQCZKIRSS-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 99.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.56 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|