C15H11NO3 — CID 114343731
N-(3-ethynylphenyl)-2,3-dihydroxybenzamide (PubChem CID 114343731) has the molecular formula C15H11NO3 and a molecular weight of 253.26 g/mol. Its IUPAC name is N-(3-ethynylphenyl)-2,3-dihydroxybenzamide.
| Compound Name | N-(3-ethynylphenyl)-2,3-dihydroxybenzamide |
|---|---|
| PubChem CID | 114343731 |
| Molecular Formula | C15H11NO3 |
| Molecular Weight | 253.26 g/mol |
| Exact Mass | 253.07 |
| IUPAC Name | N-(3-ethynylphenyl)-2,3-dihydroxybenzamide |
| SMILES | C#Cc1cccc(NC(=O)c2cccc(O)c2O)c1 |
| InChI | InChI=1S/C15H11NO3/c1-2-10-5-3-6-11(9-10)16-15(19)12-7-4-8-13(17)14(12)18/h1,3-9,17-18H,(H,16,19) |
| InChIKey | SPBMLPUONYAMPS-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.26 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|