C15H8Cl2FNO — CID 51330118
2,4-dichloro-N-(3-ethynylphenyl)-5-fluorobenzamide (PubChem CID 51330118) has the molecular formula C15H8Cl2FNO and a molecular weight of 308.14 g/mol. Its IUPAC name is 2,4-dichloro-N-(3-ethynylphenyl)-5-fluorobenzamide.
| Compound Name | 2,4-dichloro-N-(3-ethynylphenyl)-5-fluorobenzamide |
|---|---|
| PubChem CID | 51330118 |
| Molecular Formula | C15H8Cl2FNO |
| Molecular Weight | 308.14 g/mol |
| Exact Mass | 307.00 |
| IUPAC Name | 2,4-dichloro-N-(3-ethynylphenyl)-5-fluorobenzamide |
| SMILES | C#Cc1cccc(NC(=O)c2cc(F)c(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C15H8Cl2FNO/c1-2-9-4-3-5-10(6-9)19-15(20)11-7-14(18)13(17)8-12(11)16/h1,3-8H,(H,19,20) |
| InChIKey | IYHUUYCCMZQCAL-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.14 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|