C15H10INO — CID 24676235
N-(3-ethynylphenyl)-2-iodobenzamide (PubChem CID 24676235) has the molecular formula C15H10INO and a molecular weight of 347.16 g/mol. Its IUPAC name is N-(3-ethynylphenyl)-2-iodobenzamide.
| Compound Name | N-(3-ethynylphenyl)-2-iodobenzamide |
|---|---|
| PubChem CID | 24676235 |
| Molecular Formula | C15H10INO |
| Molecular Weight | 347.16 g/mol |
| Exact Mass | 346.98 |
| IUPAC Name | N-(3-ethynylphenyl)-2-iodobenzamide |
| SMILES | C#Cc1cccc(NC(=O)c2ccccc2I)c1 |
| InChI | InChI=1S/C15H10INO/c1-2-11-6-5-7-12(10-11)17-15(18)13-8-3-4-9-14(13)16/h1,3-10H,(H,17,18) |
| InChIKey | LRXOUBSYHQLSDM-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.16 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|