C15H12FN3O3S — CID 162421413
N-[3-[(3-ethynylphenyl)carbamoylamino]phenyl]sulfamoyl fluoride (PubChem CID 162421413) has the molecular formula C15H12FN3O3S and a molecular weight of 333.34 g/mol. Its IUPAC name is N-[3-[(3-ethynylphenyl)carbamoylamino]phenyl]sulfamoyl fluoride.
| Compound Name | N-[3-[(3-ethynylphenyl)carbamoylamino]phenyl]sulfamoyl fluoride |
|---|---|
| PubChem CID | 162421413 |
| Molecular Formula | C15H12FN3O3S |
| Molecular Weight | 333.34 g/mol |
| Exact Mass | 333.06 |
| IUPAC Name | N-[3-[(3-ethynylphenyl)carbamoylamino]phenyl]sulfamoyl fluoride |
| SMILES | C#Cc1cccc(NC(=O)Nc2cccc(NS(=O)(=O)F)c2)c1 |
| InChI | InChI=1S/C15H12FN3O3S/c1-2-11-5-3-6-12(9-11)17-15(20)18-13-7-4-8-14(10-13)19-23(16,21)22/h1,3-10,19H,(H2,17,18,20) |
| InChIKey | NPBBAKYBZLQHCH-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.34 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|