C11H9F3N2O — CID 115583941
1-(3-ethynylphenyl)-3-(2,2,2-trifluoroethyl)urea (PubChem CID 115583941) has the molecular formula C11H9F3N2O and a molecular weight of 242.20 g/mol. Its IUPAC name is 1-(3-ethynylphenyl)-3-(2,2,2-trifluoroethyl)urea.
| Compound Name | 1-(3-ethynylphenyl)-3-(2,2,2-trifluoroethyl)urea |
|---|---|
| PubChem CID | 115583941 |
| Molecular Formula | C11H9F3N2O |
| Molecular Weight | 242.20 g/mol |
| Exact Mass | 242.07 |
| IUPAC Name | 1-(3-ethynylphenyl)-3-(2,2,2-trifluoroethyl)urea |
| SMILES | C#Cc1cccc(NC(=O)NCC(F)(F)F)c1 |
| InChI | InChI=1S/C11H9F3N2O/c1-2-8-4-3-5-9(6-8)16-10(17)15-7-11(12,13)14/h1,3-6H,7H2,(H2,15,16,17) |
| InChIKey | ATFVBOUGWHHRMS-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.20 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|