C12H11F3N2O — CID 78924300
N-(3-ethynylphenyl)-2-(2,2,2-trifluoroethylamino)acetamide (PubChem CID 78924300) has the molecular formula C12H11F3N2O and a molecular weight of 256.23 g/mol. Its IUPAC name is N-(3-ethynylphenyl)-2-(2,2,2-trifluoroethylamino)acetamide.
| Compound Name | N-(3-ethynylphenyl)-2-(2,2,2-trifluoroethylamino)acetamide |
|---|---|
| PubChem CID | 78924300 |
| Molecular Formula | C12H11F3N2O |
| Molecular Weight | 256.23 g/mol |
| Exact Mass | 256.08 |
| IUPAC Name | N-(3-ethynylphenyl)-2-(2,2,2-trifluoroethylamino)acetamide |
| SMILES | C#Cc1cccc(NC(=O)CNCC(F)(F)F)c1 |
| InChI | InChI=1S/C12H11F3N2O/c1-2-9-4-3-5-10(6-9)17-11(18)7-16-8-12(13,14)15/h1,3-6,16H,7-8H2,(H,17,18) |
| InChIKey | YQODOIRMDQCXSJ-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.23 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|