C18H23N3O3 — CID 51090668
N-[3-[[2-(3-ethynylanilino)-2-oxoethyl]amino]-3-oxopropyl]-2,2-dimethylpropanamide (PubChem CID 51090668) has the molecular formula C18H23N3O3 and a molecular weight of 329.40 g/mol. Its IUPAC name is N-[3-[[2-(3-ethynylanilino)-2-oxoethyl]amino]-3-oxopropyl]-2,2-dimethylpropanamide.
| Compound Name | N-[3-[[2-(3-ethynylanilino)-2-oxoethyl]amino]-3-oxopropyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 51090668 |
| Molecular Formula | C18H23N3O3 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | N-[3-[[2-(3-ethynylanilino)-2-oxoethyl]amino]-3-oxopropyl]-2,2-dimethylpropanamide |
| SMILES | C#Cc1cccc(NC(=O)CNC(=O)CCNC(=O)C(C)(C)C)c1 |
| InChI | InChI=1S/C18H23N3O3/c1-5-13-7-6-8-14(11-13)21-16(23)12-20-15(22)9-10-19-17(24)18(2,3)4/h1,6-8,11H,9-10,12H2,2-4H3,(H,19,24)(H,20,22)(H,21,23) |
| InChIKey | NNZLTKXBOHULIM-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|