C16H23N3O3 — CID 33171708
3-[3-(2,2-dimethylpropanoylamino)propanoylamino]-N-methylbenzamide (PubChem CID 33171708) has the molecular formula C16H23N3O3 and a molecular weight of 305.38 g/mol. Its IUPAC name is 3-[3-(2,2-dimethylpropanoylamino)propanoylamino]-N-methylbenzamide.
| Compound Name | 3-[3-(2,2-dimethylpropanoylamino)propanoylamino]-N-methylbenzamide |
|---|---|
| PubChem CID | 33171708 |
| Molecular Formula | C16H23N3O3 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.17 |
| IUPAC Name | 3-[3-(2,2-dimethylpropanoylamino)propanoylamino]-N-methylbenzamide |
| SMILES | CNC(=O)c1cccc(NC(=O)CCNC(=O)C(C)(C)C)c1 |
| InChI | InChI=1S/C16H23N3O3/c1-16(2,3)15(22)18-9-8-13(20)19-12-7-5-6-11(10-12)14(21)17-4/h5-7,10H,8-9H2,1-4H3,(H,17,21)(H,18,22)(H,19,20) |
| InChIKey | CTRAKLQBBORSNR-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |