C13H17ClN2O2 — CID 63678627
3-[(3-chloro-2,2-dimethylpropanoyl)amino]-N-methylbenzamide (PubChem CID 63678627) has the molecular formula C13H17ClN2O2 and a molecular weight of 268.74 g/mol. Its IUPAC name is 3-[(3-chloro-2,2-dimethylpropanoyl)amino]-N-methylbenzamide.
| Compound Name | 3-[(3-chloro-2,2-dimethylpropanoyl)amino]-N-methylbenzamide |
|---|---|
| PubChem CID | 63678627 |
| Molecular Formula | C13H17ClN2O2 |
| Molecular Weight | 268.74 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | 3-[(3-chloro-2,2-dimethylpropanoyl)amino]-N-methylbenzamide |
| SMILES | CNC(=O)c1cccc(NC(=O)C(C)(C)CCl)c1 |
| InChI | InChI=1S/C13H17ClN2O2/c1-13(2,8-14)12(18)16-10-6-4-5-9(7-10)11(17)15-3/h4-7H,8H2,1-3H3,(H,15,17)(H,16,18) |
| InChIKey | PSBAFXCYQMATGD-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.74 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|