C16H23ClN2O2 — CID 63680145
3-[(3-chloro-2,2-dimethylpropanoyl)amino]-N,N-diethylbenzamide (PubChem CID 63680145) has the molecular formula C16H23ClN2O2 and a molecular weight of 310.82 g/mol. Its IUPAC name is 3-[(3-chloro-2,2-dimethylpropanoyl)amino]-N,N-diethylbenzamide.
| Compound Name | 3-[(3-chloro-2,2-dimethylpropanoyl)amino]-N,N-diethylbenzamide |
|---|---|
| PubChem CID | 63680145 |
| Molecular Formula | C16H23ClN2O2 |
| Molecular Weight | 310.82 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | 3-[(3-chloro-2,2-dimethylpropanoyl)amino]-N,N-diethylbenzamide |
| SMILES | CCN(CC)C(=O)c1cccc(NC(=O)C(C)(C)CCl)c1 |
| InChI | InChI=1S/C16H23ClN2O2/c1-5-19(6-2)14(20)12-8-7-9-13(10-12)18-15(21)16(3,4)11-17/h7-10H,5-6,11H2,1-4H3,(H,18,21) |
| InChIKey | VGVAUHXBMHYGLD-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.82 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|