C20H25N3O2 — CID 120587025
3-[(2-amino-2-phenylpropanoyl)amino]-N,N-diethylbenzamide (PubChem CID 120587025) has the molecular formula C20H25N3O2 and a molecular weight of 339.44 g/mol. Its IUPAC name is 3-[(2-amino-2-phenylpropanoyl)amino]-N,N-diethylbenzamide.
| Compound Name | 3-[(2-amino-2-phenylpropanoyl)amino]-N,N-diethylbenzamide |
|---|---|
| PubChem CID | 120587025 |
| Molecular Formula | C20H25N3O2 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.19 |
| IUPAC Name | 3-[(2-amino-2-phenylpropanoyl)amino]-N,N-diethylbenzamide |
| SMILES | CCN(CC)C(=O)c1cccc(NC(=O)C(C)(N)c2ccccc2)c1 |
| InChI | InChI=1S/C20H25N3O2/c1-4-23(5-2)18(24)15-10-9-13-17(14-15)22-19(25)20(3,21)16-11-7-6-8-12-16/h6-14H,4-5,21H2,1-3H3,(H,22,25) |
| InChIKey | XFWLLUGBHNLHTO-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |