C17H27N3O2 — CID 119685445
3-[[(2S)-2-amino-4-methylpentanoyl]amino]-N,N-diethylbenzamide (PubChem CID 119685445) has the molecular formula C17H27N3O2 and a molecular weight of 305.42 g/mol. Its IUPAC name is 3-[[(2S)-2-amino-4-methylpentanoyl]amino]-N,N-diethylbenzamide.
| Compound Name | 3-[[(2S)-2-amino-4-methylpentanoyl]amino]-N,N-diethylbenzamide |
|---|---|
| PubChem CID | 119685445 |
| Molecular Formula | C17H27N3O2 |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.21 |
| IUPAC Name | 3-[[(2S)-2-amino-4-methylpentanoyl]amino]-N,N-diethylbenzamide |
| SMILES | CCN(CC)C(=O)c1cccc(NC(=O)[C@@H](N)CC(C)C)c1 |
| InChI | InChI=1S/C17H27N3O2/c1-5-20(6-2)17(22)13-8-7-9-14(11-13)19-16(21)15(18)10-12(3)4/h7-9,11-12,15H,5-6,10,18H2,1-4H3,(H,19,21)/t15-/m0/s1 |
| InChIKey | GULAGQNANSECMN-HNNXBMFYSA-N |
| XLogP | 2.48 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |