C24H31N3O3 — CID 24626096
3-[(2-benzamido-3-methylpentanoyl)amino]-N,N-diethylbenzamide (PubChem CID 24626096) has the molecular formula C24H31N3O3 and a molecular weight of 409.53 g/mol. Its IUPAC name is 3-[(2-benzamido-3-methylpentanoyl)amino]-N,N-diethylbenzamide.
| Compound Name | 3-[(2-benzamido-3-methylpentanoyl)amino]-N,N-diethylbenzamide |
|---|---|
| PubChem CID | 24626096 |
| Molecular Formula | C24H31N3O3 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.24 |
| IUPAC Name | 3-[(2-benzamido-3-methylpentanoyl)amino]-N,N-diethylbenzamide |
| SMILES | CCC(C)C(NC(=O)c1ccccc1)C(=O)Nc1cccc(C(=O)N(CC)CC)c1 |
| InChI | InChI=1S/C24H31N3O3/c1-5-17(4)21(26-22(28)18-12-9-8-10-13-18)23(29)25-20-15-11-14-19(16-20)24(30)27(6-2)7-3/h8-17,21H,5-7H2,1-4H3,(H,25,29)(H,26,28) |
| InChIKey | ZGCTVNYXXQANLO-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |