C20H32N4O3 — CID 86997037
N-[2-(diethylamino)propyl]-N'-[3-(diethylcarbamoyl)phenyl]oxamide (PubChem CID 86997037) has the molecular formula C20H32N4O3 and a molecular weight of 376.50 g/mol. Its IUPAC name is N-[2-(diethylamino)propyl]-N'-[3-(diethylcarbamoyl)phenyl]oxamide.
| Compound Name | N-[2-(diethylamino)propyl]-N'-[3-(diethylcarbamoyl)phenyl]oxamide |
|---|---|
| PubChem CID | 86997037 |
| Molecular Formula | C20H32N4O3 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.25 |
| IUPAC Name | N-[2-(diethylamino)propyl]-N'-[3-(diethylcarbamoyl)phenyl]oxamide |
| SMILES | CCN(CC)C(=O)c1cccc(NC(=O)C(=O)NCC(C)N(CC)CC)c1 |
| InChI | InChI=1S/C20H32N4O3/c1-6-23(7-2)15(5)14-21-18(25)19(26)22-17-12-10-11-16(13-17)20(27)24(8-3)9-4/h10-13,15H,6-9,14H2,1-5H3,(H,21,25)(H,22,26) |
| InChIKey | SCKNCMGCRGUZGQ-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|