C23H28N2O4 — CID 8568240
[2-[3-(diethylcarbamoyl)anilino]-2-oxoethyl] 2-methyl-2-phenylpropanoate (PubChem CID 8568240) has the molecular formula C23H28N2O4 and a molecular weight of 396.49 g/mol. Its IUPAC name is [2-[3-(diethylcarbamoyl)anilino]-2-oxoethyl] 2-methyl-2-phenylpropanoate.
| Compound Name | [2-[3-(diethylcarbamoyl)anilino]-2-oxoethyl] 2-methyl-2-phenylpropanoate |
|---|---|
| PubChem CID | 8568240 |
| Molecular Formula | C23H28N2O4 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | [2-[3-(diethylcarbamoyl)anilino]-2-oxoethyl] 2-methyl-2-phenylpropanoate |
| SMILES | CCN(CC)C(=O)c1cccc(NC(=O)COC(=O)C(C)(C)c2ccccc2)c1 |
| InChI | InChI=1S/C23H28N2O4/c1-5-25(6-2)21(27)17-11-10-14-19(15-17)24-20(26)16-29-22(28)23(3,4)18-12-8-7-9-13-18/h7-15H,5-6,16H2,1-4H3,(H,24,26) |
| InChIKey | TZVLRRDKLXGVOT-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |