C22H26N2O4 — CID 9290674
[2-[3-(diethylcarbamoyl)anilino]-2-oxoethyl] 3,4-dimethylbenzoate (PubChem CID 9290674) has the molecular formula C22H26N2O4 and a molecular weight of 382.46 g/mol. Its IUPAC name is [2-[3-(diethylcarbamoyl)anilino]-2-oxoethyl] 3,4-dimethylbenzoate.
| Compound Name | [2-[3-(diethylcarbamoyl)anilino]-2-oxoethyl] 3,4-dimethylbenzoate |
|---|---|
| PubChem CID | 9290674 |
| Molecular Formula | C22H26N2O4 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | [2-[3-(diethylcarbamoyl)anilino]-2-oxoethyl] 3,4-dimethylbenzoate |
| SMILES | CCN(CC)C(=O)c1cccc(NC(=O)COC(=O)c2ccc(C)c(C)c2)c1 |
| InChI | InChI=1S/C22H26N2O4/c1-5-24(6-2)21(26)17-8-7-9-19(13-17)23-20(25)14-28-22(27)18-11-10-15(3)16(4)12-18/h7-13H,5-6,14H2,1-4H3,(H,23,25) |
| InChIKey | KUIBIDLAYJFARE-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |