C21H26N2O3 — CID 31288850
3-[[2-(2,3-dimethylphenoxy)acetyl]amino]-N,N-diethylbenzamide (PubChem CID 31288850) has the molecular formula C21H26N2O3 and a molecular weight of 354.45 g/mol. Its IUPAC name is 3-[[2-(2,3-dimethylphenoxy)acetyl]amino]-N,N-diethylbenzamide.
| Compound Name | 3-[[2-(2,3-dimethylphenoxy)acetyl]amino]-N,N-diethylbenzamide |
|---|---|
| PubChem CID | 31288850 |
| Molecular Formula | C21H26N2O3 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.19 |
| IUPAC Name | 3-[[2-(2,3-dimethylphenoxy)acetyl]amino]-N,N-diethylbenzamide |
| SMILES | CCN(CC)C(=O)c1cccc(NC(=O)COc2cccc(C)c2C)c1 |
| InChI | InChI=1S/C21H26N2O3/c1-5-23(6-2)21(25)17-10-8-11-18(13-17)22-20(24)14-26-19-12-7-9-15(3)16(19)4/h7-13H,5-6,14H2,1-4H3,(H,22,24) |
| InChIKey | IULADUNJPUDUPS-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |