C19H21BrN2O3 — CID 27875323
3-[[2-(3-bromophenoxy)acetyl]amino]-N,N-diethylbenzamide (PubChem CID 27875323) has the molecular formula C19H21BrN2O3 and a molecular weight of 405.29 g/mol. Its IUPAC name is 3-[[2-(3-bromophenoxy)acetyl]amino]-N,N-diethylbenzamide.
| Compound Name | 3-[[2-(3-bromophenoxy)acetyl]amino]-N,N-diethylbenzamide |
|---|---|
| PubChem CID | 27875323 |
| Molecular Formula | C19H21BrN2O3 |
| Molecular Weight | 405.29 g/mol |
| Exact Mass | 404.07 |
| IUPAC Name | 3-[[2-(3-bromophenoxy)acetyl]amino]-N,N-diethylbenzamide |
| SMILES | CCN(CC)C(=O)c1cccc(NC(=O)COc2cccc(Br)c2)c1 |
| InChI | InChI=1S/C19H21BrN2O3/c1-3-22(4-2)19(24)14-7-5-9-16(11-14)21-18(23)13-25-17-10-6-8-15(20)12-17/h5-12H,3-4,13H2,1-2H3,(H,21,23) |
| InChIKey | LQTLTCFHHJHNCO-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.29 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |