C19H20N2O4 — CID 2582184
[2-(3,4-dimethylanilino)-2-oxoethyl] 3-acetamidobenzoate (PubChem CID 2582184) has the molecular formula C19H20N2O4 and a molecular weight of 340.38 g/mol. Its IUPAC name is [2-(3,4-dimethylanilino)-2-oxoethyl] 3-acetamidobenzoate.
| Compound Name | [2-(3,4-dimethylanilino)-2-oxoethyl] 3-acetamidobenzoate |
|---|---|
| PubChem CID | 2582184 |
| Molecular Formula | C19H20N2O4 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | [2-(3,4-dimethylanilino)-2-oxoethyl] 3-acetamidobenzoate |
| SMILES | CC(=O)Nc1cccc(C(=O)OCC(=O)Nc2ccc(C)c(C)c2)c1 |
| InChI | InChI=1S/C19H20N2O4/c1-12-7-8-17(9-13(12)2)21-18(23)11-25-19(24)15-5-4-6-16(10-15)20-14(3)22/h4-10H,11H2,1-3H3,(H,20,22)(H,21,23) |
| InChIKey | WPSMEPMJCLTMJL-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |