C19H19N3O5 — CID 2582447
[2-(4-acetamidoanilino)-2-oxoethyl] 3-acetamidobenzoate (PubChem CID 2582447) has the molecular formula C19H19N3O5 and a molecular weight of 369.38 g/mol. Its IUPAC name is [2-(4-acetamidoanilino)-2-oxoethyl] 3-acetamidobenzoate.
| Compound Name | [2-(4-acetamidoanilino)-2-oxoethyl] 3-acetamidobenzoate |
|---|---|
| PubChem CID | 2582447 |
| Molecular Formula | C19H19N3O5 |
| Molecular Weight | 369.38 g/mol |
| Exact Mass | 369.13 |
| IUPAC Name | [2-(4-acetamidoanilino)-2-oxoethyl] 3-acetamidobenzoate |
| SMILES | CC(=O)Nc1ccc(NC(=O)COC(=O)c2cccc(NC(C)=O)c2)cc1 |
| InChI | InChI=1S/C19H19N3O5/c1-12(23)20-15-6-8-16(9-7-15)22-18(25)11-27-19(26)14-4-3-5-17(10-14)21-13(2)24/h3-10H,11H2,1-2H3,(H,20,23)(H,21,24)(H,22,25) |
| InChIKey | KVDPVNPXKPQACX-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.38 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |