C18H16Br2N2O4 — CID 42970130
[2-(2,6-dibromo-4-methylanilino)-2-oxoethyl] 3-acetamidobenzoate (PubChem CID 42970130) has the molecular formula C18H16Br2N2O4 and a molecular weight of 484.14 g/mol. Its IUPAC name is [2-(2,6-dibromo-4-methylanilino)-2-oxoethyl] 3-acetamidobenzoate.
| Compound Name | [2-(2,6-dibromo-4-methylanilino)-2-oxoethyl] 3-acetamidobenzoate |
|---|---|
| PubChem CID | 42970130 |
| Molecular Formula | C18H16Br2N2O4 |
| Molecular Weight | 484.14 g/mol |
| Exact Mass | 481.95 |
| IUPAC Name | [2-(2,6-dibromo-4-methylanilino)-2-oxoethyl] 3-acetamidobenzoate |
| SMILES | CC(=O)Nc1cccc(C(=O)OCC(=O)Nc2c(Br)cc(C)cc2Br)c1 |
| InChI | InChI=1S/C18H16Br2N2O4/c1-10-6-14(19)17(15(20)7-10)22-16(24)9-26-18(25)12-4-3-5-13(8-12)21-11(2)23/h3-8H,9H2,1-2H3,(H,21,23)(H,22,24) |
| InChIKey | RAMYHTYLBITDNM-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.14 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |