C15H12Br2N2O3 — CID 23796072
[2-(2,6-dibromo-4-methylanilino)-2-oxoethyl] pyridine-4-carboxylate (PubChem CID 23796072) has the molecular formula C15H12Br2N2O3 and a molecular weight of 428.08 g/mol. Its IUPAC name is [2-(2,6-dibromo-4-methylanilino)-2-oxoethyl] pyridine-4-carboxylate.
| Compound Name | [2-(2,6-dibromo-4-methylanilino)-2-oxoethyl] pyridine-4-carboxylate |
|---|---|
| PubChem CID | 23796072 |
| Molecular Formula | C15H12Br2N2O3 |
| Molecular Weight | 428.08 g/mol |
| Exact Mass | 425.92 |
| IUPAC Name | [2-(2,6-dibromo-4-methylanilino)-2-oxoethyl] pyridine-4-carboxylate |
| SMILES | Cc1cc(Br)c(NC(=O)COC(=O)c2ccncc2)c(Br)c1 |
| InChI | InChI=1S/C15H12Br2N2O3/c1-9-6-11(16)14(12(17)7-9)19-13(20)8-22-15(21)10-2-4-18-5-3-10/h2-7H,8H2,1H3,(H,19,20) |
| InChIKey | YQXUIIHIVWMPKA-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.08 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |