C15H10Br2Cl2N2O3 — CID 41156995
[2-(2,6-dibromo-4-methylanilino)-2-oxoethyl] 3,6-dichloropyridine-2-carboxylate (PubChem CID 41156995) has the molecular formula C15H10Br2Cl2N2O3 and a molecular weight of 496.97 g/mol. Its IUPAC name is [2-(2,6-dibromo-4-methylanilino)-2-oxoethyl] 3,6-dichloropyridine-2-carboxylate.
| Compound Name | [2-(2,6-dibromo-4-methylanilino)-2-oxoethyl] 3,6-dichloropyridine-2-carboxylate |
|---|---|
| PubChem CID | 41156995 |
| Molecular Formula | C15H10Br2Cl2N2O3 |
| Molecular Weight | 496.97 g/mol |
| Exact Mass | 493.84 |
| IUPAC Name | [2-(2,6-dibromo-4-methylanilino)-2-oxoethyl] 3,6-dichloropyridine-2-carboxylate |
| SMILES | Cc1cc(Br)c(NC(=O)COC(=O)c2nc(Cl)ccc2Cl)c(Br)c1 |
| InChI | InChI=1S/C15H10Br2Cl2N2O3/c1-7-4-8(16)13(9(17)5-7)21-12(22)6-24-15(23)14-10(18)2-3-11(19)20-14/h2-5H,6H2,1H3,(H,21,22) |
| InChIKey | NUJHEOAEMPAATN-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.97 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|