C14H9Cl3N2O3 — CID 2485209
[2-(4-chloroanilino)-2-oxoethyl] 3,6-dichloropyridine-2-carboxylate (PubChem CID 2485209) has the molecular formula C14H9Cl3N2O3 and a molecular weight of 359.60 g/mol. Its IUPAC name is [2-(4-chloroanilino)-2-oxoethyl] 3,6-dichloropyridine-2-carboxylate.
| Compound Name | [2-(4-chloroanilino)-2-oxoethyl] 3,6-dichloropyridine-2-carboxylate |
|---|---|
| PubChem CID | 2485209 |
| Molecular Formula | C14H9Cl3N2O3 |
| Molecular Weight | 359.60 g/mol |
| Exact Mass | 357.97 |
| IUPAC Name | [2-(4-chloroanilino)-2-oxoethyl] 3,6-dichloropyridine-2-carboxylate |
| SMILES | O=C(COC(=O)c1nc(Cl)ccc1Cl)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H9Cl3N2O3/c15-8-1-3-9(4-2-8)18-12(20)7-22-14(21)13-10(16)5-6-11(17)19-13/h1-6H,7H2,(H,18,20) |
| InChIKey | XVQJMLROMYZHAD-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.60 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|