C14H8Cl4N2O3 — CID 3644407
[2-(3,4-dichloroanilino)-2-oxoethyl] 3,6-dichloropyridine-2-carboxylate (PubChem CID 3644407) has the molecular formula C14H8Cl4N2O3 and a molecular weight of 394.04 g/mol. Its IUPAC name is [2-(3,4-dichloroanilino)-2-oxoethyl] 3,6-dichloropyridine-2-carboxylate.
| Compound Name | [2-(3,4-dichloroanilino)-2-oxoethyl] 3,6-dichloropyridine-2-carboxylate |
|---|---|
| PubChem CID | 3644407 |
| Molecular Formula | C14H8Cl4N2O3 |
| Molecular Weight | 394.04 g/mol |
| Exact Mass | 391.93 |
| IUPAC Name | [2-(3,4-dichloroanilino)-2-oxoethyl] 3,6-dichloropyridine-2-carboxylate |
| SMILES | O=C(COC(=O)c1nc(Cl)ccc1Cl)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C14H8Cl4N2O3/c15-8-2-1-7(5-10(8)17)19-12(21)6-23-14(22)13-9(16)3-4-11(18)20-13/h1-5H,6H2,(H,19,21) |
| InChIKey | NIZICPJGMSFXMA-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.04 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|