C21H16Cl2N2O3 — CID 3694895
[2-(3,4-dichloroanilino)-2-oxoethyl] 2-anilinobenzoate (PubChem CID 3694895) has the molecular formula C21H16Cl2N2O3 and a molecular weight of 415.28 g/mol. Its IUPAC name is [2-(3,4-dichloroanilino)-2-oxoethyl] 2-anilinobenzoate.
| Compound Name | [2-(3,4-dichloroanilino)-2-oxoethyl] 2-anilinobenzoate |
|---|---|
| PubChem CID | 3694895 |
| Molecular Formula | C21H16Cl2N2O3 |
| Molecular Weight | 415.28 g/mol |
| Exact Mass | 414.05 |
| IUPAC Name | [2-(3,4-dichloroanilino)-2-oxoethyl] 2-anilinobenzoate |
| SMILES | O=C(COC(=O)c1ccccc1Nc1ccccc1)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C21H16Cl2N2O3/c22-17-11-10-15(12-18(17)23)25-20(26)13-28-21(27)16-8-4-5-9-19(16)24-14-6-2-1-3-7-14/h1-12,24H,13H2,(H,25,26) |
| InChIKey | LYVNYLSRQLNGAY-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.28 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |