C16H14Cl2N2O4 — CID 53269931
[2-(3,4-dichloroanilino)-2-oxoethyl] 3-amino-4-methoxybenzoate (PubChem CID 53269931) has the molecular formula C16H14Cl2N2O4 and a molecular weight of 369.20 g/mol. Its IUPAC name is [2-(3,4-dichloroanilino)-2-oxoethyl] 3-amino-4-methoxybenzoate.
| Compound Name | [2-(3,4-dichloroanilino)-2-oxoethyl] 3-amino-4-methoxybenzoate |
|---|---|
| PubChem CID | 53269931 |
| Molecular Formula | C16H14Cl2N2O4 |
| Molecular Weight | 369.20 g/mol |
| Exact Mass | 368.03 |
| IUPAC Name | [2-(3,4-dichloroanilino)-2-oxoethyl] 3-amino-4-methoxybenzoate |
| SMILES | COc1ccc(C(=O)OCC(=O)Nc2ccc(Cl)c(Cl)c2)cc1N |
| InChI | InChI=1S/C16H14Cl2N2O4/c1-23-14-5-2-9(6-13(14)19)16(22)24-8-15(21)20-10-3-4-11(17)12(18)7-10/h2-7H,8,19H2,1H3,(H,20,21) |
| InChIKey | BKUJAGMYHDTQNX-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.20 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|