C17H16N2O7 — CID 53269993
5-[[2-(3-amino-4-methoxybenzoyl)oxyacetyl]amino]-2-hydroxybenzoic acid (PubChem CID 53269993) has the molecular formula C17H16N2O7 and a molecular weight of 360.32 g/mol. Its IUPAC name is 5-[[2-(3-amino-4-methoxybenzoyl)oxyacetyl]amino]-2-hydroxybenzoic acid.
| Compound Name | 5-[[2-(3-amino-4-methoxybenzoyl)oxyacetyl]amino]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 53269993 |
| Molecular Formula | C17H16N2O7 |
| Molecular Weight | 360.32 g/mol |
| Exact Mass | 360.10 |
| IUPAC Name | 5-[[2-(3-amino-4-methoxybenzoyl)oxyacetyl]amino]-2-hydroxybenzoic acid |
| SMILES | COc1ccc(C(=O)OCC(=O)Nc2ccc(O)c(C(=O)O)c2)cc1N |
| InChI | InChI=1S/C17H16N2O7/c1-25-14-5-2-9(6-12(14)18)17(24)26-8-15(21)19-10-3-4-13(20)11(7-10)16(22)23/h2-7,20H,8,18H2,1H3,(H,19,21)(H,22,23) |
| InChIKey | IZRCTFYVLBKOBC-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 148.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.32 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|