C16H11ClF3NO4 — CID 2444631
[2-oxo-2-[4-(trifluoromethoxy)anilino]ethyl] 4-chlorobenzoate (PubChem CID 2444631) has the molecular formula C16H11ClF3NO4 and a molecular weight of 373.71 g/mol. Its IUPAC name is [2-oxo-2-[4-(trifluoromethoxy)anilino]ethyl] 4-chlorobenzoate.
| Compound Name | [2-oxo-2-[4-(trifluoromethoxy)anilino]ethyl] 4-chlorobenzoate |
|---|---|
| PubChem CID | 2444631 |
| Molecular Formula | C16H11ClF3NO4 |
| Molecular Weight | 373.71 g/mol |
| Exact Mass | 373.03 |
| IUPAC Name | [2-oxo-2-[4-(trifluoromethoxy)anilino]ethyl] 4-chlorobenzoate |
| SMILES | O=C(COC(=O)c1ccc(Cl)cc1)Nc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C16H11ClF3NO4/c17-11-3-1-10(2-4-11)15(23)24-9-14(22)21-12-5-7-13(8-6-12)25-16(18,19)20/h1-8H,9H2,(H,21,22) |
| InChIKey | UKTXKJWXYRPKDL-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.71 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |