C21H15F3N2O5S — CID 46815244
[2-oxo-2-[4-(trifluoromethoxy)anilino]ethyl] 4-(thiophene-2-carbonylamino)benzoate (PubChem CID 46815244) has the molecular formula C21H15F3N2O5S and a molecular weight of 464.42 g/mol. Its IUPAC name is [2-oxo-2-[4-(trifluoromethoxy)anilino]ethyl] 4-(thiophene-2-carbonylamino)benzoate.
| Compound Name | [2-oxo-2-[4-(trifluoromethoxy)anilino]ethyl] 4-(thiophene-2-carbonylamino)benzoate |
|---|---|
| PubChem CID | 46815244 |
| Molecular Formula | C21H15F3N2O5S |
| Molecular Weight | 464.42 g/mol |
| Exact Mass | 464.07 |
| IUPAC Name | [2-oxo-2-[4-(trifluoromethoxy)anilino]ethyl] 4-(thiophene-2-carbonylamino)benzoate |
| SMILES | O=C(COC(=O)c1ccc(NC(=O)c2cccs2)cc1)Nc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C21H15F3N2O5S/c22-21(23,24)31-16-9-7-14(8-10-16)25-18(27)12-30-20(29)13-3-5-15(6-4-13)26-19(28)17-2-1-11-32-17/h1-11H,12H2,(H,25,27)(H,26,28) |
| InChIKey | PTJYBHZBXPBYOB-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.42 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |