C20H14ClFN2O4S — CID 30118810
[2-(4-chloro-2-fluoroanilino)-2-oxoethyl] 4-(thiophene-2-carbonylamino)benzoate (PubChem CID 30118810) has the molecular formula C20H14ClFN2O4S and a molecular weight of 432.86 g/mol. Its IUPAC name is [2-(4-chloro-2-fluoroanilino)-2-oxoethyl] 4-(thiophene-2-carbonylamino)benzoate.
| Compound Name | [2-(4-chloro-2-fluoroanilino)-2-oxoethyl] 4-(thiophene-2-carbonylamino)benzoate |
|---|---|
| PubChem CID | 30118810 |
| Molecular Formula | C20H14ClFN2O4S |
| Molecular Weight | 432.86 g/mol |
| Exact Mass | 432.03 |
| IUPAC Name | [2-(4-chloro-2-fluoroanilino)-2-oxoethyl] 4-(thiophene-2-carbonylamino)benzoate |
| SMILES | O=C(COC(=O)c1ccc(NC(=O)c2cccs2)cc1)Nc1ccc(Cl)cc1F |
| InChI | InChI=1S/C20H14ClFN2O4S/c21-13-5-8-16(15(22)10-13)24-18(25)11-28-20(27)12-3-6-14(7-4-12)23-19(26)17-2-1-9-29-17/h1-10H,11H2,(H,23,26)(H,24,25) |
| InChIKey | MLWBSQNPCULNCA-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.86 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |