C15H10BrClFNO3 — CID 2625811
[2-(4-chloro-2-fluoroanilino)-2-oxoethyl] 4-bromobenzoate (PubChem CID 2625811) has the molecular formula C15H10BrClFNO3 and a molecular weight of 386.60 g/mol. Its IUPAC name is [2-(4-chloro-2-fluoroanilino)-2-oxoethyl] 4-bromobenzoate.
| Compound Name | [2-(4-chloro-2-fluoroanilino)-2-oxoethyl] 4-bromobenzoate |
|---|---|
| PubChem CID | 2625811 |
| Molecular Formula | C15H10BrClFNO3 |
| Molecular Weight | 386.60 g/mol |
| Exact Mass | 384.95 |
| IUPAC Name | [2-(4-chloro-2-fluoroanilino)-2-oxoethyl] 4-bromobenzoate |
| SMILES | O=C(COC(=O)c1ccc(Br)cc1)Nc1ccc(Cl)cc1F |
| InChI | InChI=1S/C15H10BrClFNO3/c16-10-3-1-9(2-4-10)15(21)22-8-14(20)19-13-6-5-11(17)7-12(13)18/h1-7H,8H2,(H,19,20) |
| InChIKey | LJFMMZCUCMRBPZ-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.60 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |