C21H15F2NO4 — CID 7133651
[2-(2,4-difluoroanilino)-2-oxoethyl] 4-(4-hydroxyphenyl)benzoate (PubChem CID 7133651) has the molecular formula C21H15F2NO4 and a molecular weight of 383.35 g/mol. Its IUPAC name is [2-(2,4-difluoroanilino)-2-oxoethyl] 4-(4-hydroxyphenyl)benzoate.
| Compound Name | [2-(2,4-difluoroanilino)-2-oxoethyl] 4-(4-hydroxyphenyl)benzoate |
|---|---|
| PubChem CID | 7133651 |
| Molecular Formula | C21H15F2NO4 |
| Molecular Weight | 383.35 g/mol |
| Exact Mass | 383.10 |
| IUPAC Name | [2-(2,4-difluoroanilino)-2-oxoethyl] 4-(4-hydroxyphenyl)benzoate |
| SMILES | O=C(COC(=O)c1ccc(-c2ccc(O)cc2)cc1)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C21H15F2NO4/c22-16-7-10-19(18(23)11-16)24-20(26)12-28-21(27)15-3-1-13(2-4-15)14-5-8-17(25)9-6-14/h1-11,25H,12H2,(H,24,26) |
| InChIKey | AALCFVRDTILSGQ-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.35 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |